C12H17NO7S — CID 171873303
2-[[4-(1,2,4-trihydroxybutyl)phenyl]sulfonylamino]acetic acid (PubChem CID 171873303) has the molecular formula C12H17NO7S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[[4-(1,2,4-trihydroxybutyl)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(1,2,4-trihydroxybutyl)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 171873303 |
| Molecular Formula | C12H17NO7S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[[4-(1,2,4-trihydroxybutyl)phenyl]sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(C(O)C(O)CCO)cc1 |
| InChI | InChI=1S/C12H17NO7S/c14-6-5-10(15)12(18)8-1-3-9(4-2-8)21(19,20)13-7-11(16)17/h1-4,10,12-15,18H,5-7H2,(H,16,17) |
| InChIKey | JJJHGRDWVHPGIE-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |