C10H11FO6S — CID 171877991
4-(4-fluorosulfonylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877991) has the molecular formula C10H11FO6S and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-(4-fluorosulfonylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-fluorosulfonylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877991 |
| Molecular Formula | C10H11FO6S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-(4-fluorosulfonylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C10H11FO6S/c11-18(16,17)7-3-1-6(2-4-7)10(15)8(12)5-9(13)14/h1-4,8,10,12,15H,5H2,(H,13,14) |
| InChIKey | MYRMOSZLRSHBBI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |