C10H12FN3O4S — CID 171879781
4-(4-azido-1,2-dihydroxybutyl)benzenesulfonyl fluoride (PubChem CID 171879781) has the molecular formula C10H12FN3O4S and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)benzenesulfonyl fluoride.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 171879781 |
| Molecular Formula | C10H12FN3O4S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)benzenesulfonyl fluoride |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C10H12FN3O4S/c11-19(17,18)8-3-1-7(2-4-8)10(16)9(15)5-6-13-14-12/h1-4,9-10,15-16H,5-6H2 |
| InChIKey | VFRFOZJIBVMANG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|