C14H17N3O5 — CID 171880417
4-[4-(4-azido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoic acid (PubChem CID 171880417) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-[4-(4-azido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-(4-azido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171880417 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[4-(4-azido-1,2-dihydroxybutyl)phenyl]-4-oxobutanoic acid |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C14H17N3O5/c15-17-16-8-7-12(19)14(22)10-3-1-9(2-4-10)11(18)5-6-13(20)21/h1-4,12,14,19,22H,5-8H2,(H,20,21) |
| InChIKey | SAXUOTNEPOUJJE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|