C13H15NO6 — CID 171869115
4-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)phenyl]-4-oxobutanoic acid (PubChem CID 171869115) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171869115 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)phenyl]-4-oxobutanoic acid |
| SMILES | NC(=O)C(O)C(O)c1ccc(C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO6/c14-13(20)12(19)11(18)8-3-1-7(2-4-8)9(15)5-6-10(16)17/h1-4,11-12,18-19H,5-6H2,(H2,14,20)(H,16,17) |
| InChIKey | SKSHBJDKOPKMCX-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |