C9H10N2O5 — CID 171868264
2,3-dihydroxy-3-(4-nitrophenyl)propanamide (PubChem CID 171868264) has the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(4-nitrophenyl)propanamide.
| Compound Name | 2,3-dihydroxy-3-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 171868264 |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2,3-dihydroxy-3-(4-nitrophenyl)propanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H10N2O5/c10-9(14)8(13)7(12)5-1-3-6(4-2-5)11(15)16/h1-4,7-8,12-13H,(H2,10,14) |
| InChIKey | KZVBYBVINFLKII-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|