C12H15NO4 — CID 102413236
(1S,2R)-1-hydroxy-2-methyl-1-(4-nitrophenyl)pentan-3-one (PubChem CID 102413236) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (1S,2R)-1-hydroxy-2-methyl-1-(4-nitrophenyl)pentan-3-one.
| Compound Name | (1S,2R)-1-hydroxy-2-methyl-1-(4-nitrophenyl)pentan-3-one |
|---|---|
| PubChem CID | 102413236 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (1S,2R)-1-hydroxy-2-methyl-1-(4-nitrophenyl)pentan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15NO4/c1-3-11(14)8(2)12(15)9-4-6-10(7-5-9)13(16)17/h4-8,12,15H,3H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | OFSNTJXABKDNRR-UFBFGSQYSA-N |
| XLogP | 2.24 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|