1-nitro-4-propan-2-ylbenzene;propanoic acid

C12H17NO4 — CID 162240103

IUPAC1-nitro-4-propan-2-ylbenzene;propanoic acid
SMILESCC(C)c1ccc([N+](=O)[O-])cc1.CCC(=O)O
InChIInChI=1S/C9H11NO2.C3H6O2/c1-7(2)8-3-5-9(6-4-8)10(11)12;1-2-3(4)5/h3-7H,1-2H3;2H2,1H3,(H,4,5)
InChIKeyZWOWQOWULIQKCM-UHFFFAOYSA-N
MW239.27 g/mol
LogP3.20
Rot. Bonds3

About 1-nitro-4-propan-2-ylbenzene;propanoic acid

1-nitro-4-propan-2-ylbenzene;propanoic acid (PubChem CID 162240103) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-nitro-4-propan-2-ylbenzene;propanoic acid.

Molecular Properties

Compound Name1-nitro-4-propan-2-ylbenzene;propanoic acid
PubChem CID162240103
Molecular FormulaC12H17NO4
Molecular Weight239.27 g/mol
Exact Mass239.12
IUPAC Name1-nitro-4-propan-2-ylbenzene;propanoic acid
SMILESCC(C)c1ccc([N+](=O)[O-])cc1.CCC(=O)O
InChIInChI=1S/C9H11NO2.C3H6O2/c1-7(2)8-3-5-9(6-4-8)10(11)12;1-2-3(4)5/h3-7H,1-2H3;2H2,1H3,(H,4,5)
InChIKeyZWOWQOWULIQKCM-UHFFFAOYSA-N
XLogP3.20
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.27
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-nitro-4-propan-2-ylbenzene;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-nitro-4-propan-2-ylbenzene;propanoic acid?
The IUPAC name of 1-nitro-4-propan-2-ylbenzene;propanoic acid (CID 162240103) is 1-nitro-4-propan-2-ylbenzene;propanoic acid.
What is the SMILES notation for 1-nitro-4-propan-2-ylbenzene;propanoic acid?
The canonical SMILES for 1-nitro-4-propan-2-ylbenzene;propanoic acid is CC(C)c1ccc([N+](=O)[O-])cc1.CCC(=O)O.
What is the InChIKey of 1-nitro-4-propan-2-ylbenzene;propanoic acid?
The InChIKey is ZWOWQOWULIQKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C3H6O2/c1-7(2)8-3-5-9(6-4-8)10(11)12;1-2-3(4)5/h3-7H,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of 1-nitro-4-propan-2-ylbenzene;propanoic acid?
1-nitro-4-propan-2-ylbenzene;propanoic acid has a molecular weight of 239.27 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-4-propan-2-ylbenzene;propanoic acid is sourced from PubChem (CID 162240103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).