About 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol
1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol (PubChem CID 87950417) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol.
Molecular Properties
| Compound Name | 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol |
| PubChem CID | 87950417 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol |
| SMILES | CC(O)c1ccc([N+](=O)[O-])cc1.CCC(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11NO3.C8H9NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13;1-6(10)7-2-4-8(5-3-7)9(11)12/h3-6,9,11H,2H2,1H3;2-6,10H,1H3 |
| InChIKey | LLHXEQSVWWNCGI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol?
The IUPAC name of 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol (CID 87950417) is 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol.
What is the SMILES notation for 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol?
The canonical SMILES for 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol is CC(O)c1ccc([N+](=O)[O-])cc1.CCC(O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol?
The InChIKey is LLHXEQSVWWNCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3.C8H9NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13;1-6(10)7-2-4-8(5-3-7)9(11)12/h3-6,9,11H,2H2,1H3;2-6,10H,1H3.
What are the key properties of 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol?
1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol has a molecular weight of 348.36 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitrophenyl)ethanol;1-(4-nitrophenyl)propan-1-ol is sourced from PubChem (CID 87950417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).