C18H18F5NO2 — CID 178123013
1-nitro-4-propan-2-ylbenzene;1,2,3,4,5-pentafluoro-6-propan-2-ylbenzene (PubChem CID 178123013) has the molecular formula C18H18F5NO2 and a molecular weight of 375.34 g/mol. Its IUPAC name is 1-nitro-4-propan-2-ylbenzene;1,2,3,4,5-pentafluoro-6-propan-2-ylbenzene.
| Compound Name | 1-nitro-4-propan-2-ylbenzene;1,2,3,4,5-pentafluoro-6-propan-2-ylbenzene |
|---|---|
| PubChem CID | 178123013 |
| Molecular Formula | C18H18F5NO2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-nitro-4-propan-2-ylbenzene;1,2,3,4,5-pentafluoro-6-propan-2-ylbenzene |
| SMILES | CC(C)c1c(F)c(F)c(F)c(F)c1F.CC(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7F5.C9H11NO2/c1-3(2)4-5(10)7(12)9(14)8(13)6(4)11;1-7(2)8-3-5-9(6-4-8)10(11)12/h3H,1-2H3;3-7H,1-2H3 |
| InChIKey | LVDUBWXKNXLHTG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|