C16H13F5N2O3 — CID 101398529
2-[methyl-[(R)-(4-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethanol (PubChem CID 101398529) has the molecular formula C16H13F5N2O3 and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-[methyl-[(R)-(4-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethanol.
| Compound Name | 2-[methyl-[(R)-(4-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 101398529 |
| Molecular Formula | C16H13F5N2O3 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-[methyl-[(R)-(4-nitrophenyl)-(2,3,4,5,6-pentafluorophenyl)methyl]amino]ethanol |
| SMILES | CN(CCO)[C@H](c1ccc([N+](=O)[O-])cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H13F5N2O3/c1-22(6-7-24)16(8-2-4-9(5-3-8)23(25)26)10-11(17)13(19)15(21)14(20)12(10)18/h2-5,16,24H,6-7H2,1H3/t16-/m1/s1 |
| InChIKey | NTBZZRQUFJKXPQ-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|