About ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene
ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene (PubChem CID 90851100) has the molecular formula C13H24N2O4
and a molecular weight of 272.35 g/mol. Its IUPAC name is ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene.
Molecular Properties
| Compound Name | ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene |
| PubChem CID | 90851100 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene |
| SMILES | CC.CN(CCO)CCO.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C5H13NO2.C2H6/c8-7(9)6-4-2-1-3-5-6;1-6(2-4-7)3-5-8;1-2/h1-5H;7-8H,2-5H2,1H3;1-2H3 |
| InChIKey | HYWDRNFTHOLAAY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene?
The IUPAC name of ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene (CID 90851100) is ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene.
What is the SMILES notation for ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene?
The canonical SMILES for ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene is CC.CN(CCO)CCO.O=[N+]([O-])c1ccccc1.
What is the InChIKey of ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene?
The InChIKey is HYWDRNFTHOLAAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C5H13NO2.C2H6/c8-7(9)6-4-2-1-3-5-6;1-6(2-4-7)3-5-8;1-2/h1-5H;7-8H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene?
ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene has a molecular weight of 272.35 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-hydroxyethyl(methyl)amino]ethanol;nitrobenzene is sourced from PubChem (CID 90851100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).