About nitrobenzene;phenylmethanol
nitrobenzene;phenylmethanol (PubChem CID 160558550) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is nitrobenzene;phenylmethanol.
Molecular Properties
| Compound Name | nitrobenzene;phenylmethanol |
| PubChem CID | 160558550 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | nitrobenzene;phenylmethanol |
| SMILES | O=[N+]([O-])c1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.C6H5NO2/c8-6-7-4-2-1-3-5-7;8-7(9)6-4-2-1-3-5-6/h1-5,8H,6H2;1-5H |
| InChIKey | QYZVIEPHTRCRGH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;phenylmethanol?
The IUPAC name of nitrobenzene;phenylmethanol (CID 160558550) is nitrobenzene;phenylmethanol.
What is the SMILES notation for nitrobenzene;phenylmethanol?
The canonical SMILES for nitrobenzene;phenylmethanol is O=[N+]([O-])c1ccccc1.OCc1ccccc1.
What is the InChIKey of nitrobenzene;phenylmethanol?
The InChIKey is QYZVIEPHTRCRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H5NO2/c8-6-7-4-2-1-3-5-7;8-7(9)6-4-2-1-3-5-6/h1-5,8H,6H2;1-5H.
What are the key properties of nitrobenzene;phenylmethanol?
nitrobenzene;phenylmethanol has a molecular weight of 231.25 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;phenylmethanol is sourced from PubChem (CID 160558550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).