About carbonic acid;4-nitrophenol;phenylmethanol
carbonic acid;4-nitrophenol;phenylmethanol (PubChem CID 129275137) has the molecular formula C14H15NO7
and a molecular weight of 309.27 g/mol. Its IUPAC name is carbonic acid;4-nitrophenol;phenylmethanol.
Molecular Properties
| Compound Name | carbonic acid;4-nitrophenol;phenylmethanol |
| PubChem CID | 129275137 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | carbonic acid;4-nitrophenol;phenylmethanol |
| SMILES | O=C(O)O.O=[N+]([O-])c1ccc(O)cc1.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.C6H5NO3.CH2O3/c8-6-7-4-2-1-3-5-7;8-6-3-1-5(2-4-6)7(9)10;2-1(3)4/h1-5,8H,6H2;1-4,8H;(H2,2,3,4) |
| InChIKey | RDJCLBYCFZAPSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;4-nitrophenol;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;4-nitrophenol;phenylmethanol?
The IUPAC name of carbonic acid;4-nitrophenol;phenylmethanol (CID 129275137) is carbonic acid;4-nitrophenol;phenylmethanol.
What is the SMILES notation for carbonic acid;4-nitrophenol;phenylmethanol?
The canonical SMILES for carbonic acid;4-nitrophenol;phenylmethanol is O=C(O)O.O=[N+]([O-])c1ccc(O)cc1.OCc1ccccc1.
What is the InChIKey of carbonic acid;4-nitrophenol;phenylmethanol?
The InChIKey is RDJCLBYCFZAPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H5NO3.CH2O3/c8-6-7-4-2-1-3-5-7;8-6-3-1-5(2-4-6)7(9)10;2-1(3)4/h1-5,8H,6H2;1-4,8H;(H2,2,3,4).
What are the key properties of carbonic acid;4-nitrophenol;phenylmethanol?
carbonic acid;4-nitrophenol;phenylmethanol has a molecular weight of 309.27 g/mol, XLogP of 2.70, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;4-nitrophenol;phenylmethanol is sourced from PubChem (CID 129275137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).