About 4-nitrophenol;phosphane
4-nitrophenol;phosphane (PubChem CID 157153413) has the molecular formula C6H8NO3P
and a molecular weight of 173.11 g/mol. Its IUPAC name is 4-nitrophenol;phosphane.
Molecular Properties
| Compound Name | 4-nitrophenol;phosphane |
| PubChem CID | 157153413 |
| Molecular Formula | C6H8NO3P |
| Molecular Weight | 173.11 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | 4-nitrophenol;phosphane |
| SMILES | O=[N+]([O-])c1ccc(O)cc1.P |
| InChI | InChI=1S/C6H5NO3.H3P/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;1H3 |
| InChIKey | BBLVLUZIHDVFPM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.11 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenol;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenol;phosphane?
The IUPAC name of 4-nitrophenol;phosphane (CID 157153413) is 4-nitrophenol;phosphane.
What is the SMILES notation for 4-nitrophenol;phosphane?
The canonical SMILES for 4-nitrophenol;phosphane is O=[N+]([O-])c1ccc(O)cc1.P.
What is the InChIKey of 4-nitrophenol;phosphane?
The InChIKey is BBLVLUZIHDVFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.H3P/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;1H3.
What are the key properties of 4-nitrophenol;phosphane?
4-nitrophenol;phosphane has a molecular weight of 173.11 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenol;phosphane is sourced from PubChem (CID 157153413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).