About 4-nitrophenol;tris(dimethylamino)sulfanium
4-nitrophenol;tris(dimethylamino)sulfanium (PubChem CID 159014687) has the molecular formula C12H23N4O3S+
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-nitrophenol;tris(dimethylamino)sulfanium.
Molecular Properties
| Compound Name | 4-nitrophenol;tris(dimethylamino)sulfanium |
| PubChem CID | 159014687 |
| Molecular Formula | C12H23N4O3S+ |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-nitrophenol;tris(dimethylamino)sulfanium |
| SMILES | CN(C)[S+](N(C)C)N(C)C.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C6H18N3S.C6H5NO3/c1-7(2)10(8(3)4)9(5)6;8-6-3-1-5(2-4-6)7(9)10/h1-6H3;1-4,8H/q+1; |
| InChIKey | JSXZXVSONMUWFW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenol;tris(dimethylamino)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenol;tris(dimethylamino)sulfanium?
The IUPAC name of 4-nitrophenol;tris(dimethylamino)sulfanium (CID 159014687) is 4-nitrophenol;tris(dimethylamino)sulfanium.
What is the SMILES notation for 4-nitrophenol;tris(dimethylamino)sulfanium?
The canonical SMILES for 4-nitrophenol;tris(dimethylamino)sulfanium is CN(C)[S+](N(C)C)N(C)C.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 4-nitrophenol;tris(dimethylamino)sulfanium?
The InChIKey is JSXZXVSONMUWFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N3S.C6H5NO3/c1-7(2)10(8(3)4)9(5)6;8-6-3-1-5(2-4-6)7(9)10/h1-6H3;1-4,8H/q+1;.
What are the key properties of 4-nitrophenol;tris(dimethylamino)sulfanium?
4-nitrophenol;tris(dimethylamino)sulfanium has a molecular weight of 303.41 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenol;tris(dimethylamino)sulfanium is sourced from PubChem (CID 159014687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).