About N,N-dipropylnitrous amide;4-nitrophenol
N,N-dipropylnitrous amide;4-nitrophenol (PubChem CID 138628252) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is N,N-dipropylnitrous amide;4-nitrophenol.
Molecular Properties
| Compound Name | N,N-dipropylnitrous amide;4-nitrophenol |
| PubChem CID | 138628252 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N,N-dipropylnitrous amide;4-nitrophenol |
| SMILES | CCCN(CCC)N=O.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C6H14N2O.C6H5NO3/c1-3-5-8(7-9)6-4-2;8-6-3-1-5(2-4-6)7(9)10/h3-6H2,1-2H3;1-4,8H |
| InChIKey | VGWLCDKNPVPIIB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropylnitrous amide;4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylnitrous amide;4-nitrophenol?
The IUPAC name of N,N-dipropylnitrous amide;4-nitrophenol (CID 138628252) is N,N-dipropylnitrous amide;4-nitrophenol.
What is the SMILES notation for N,N-dipropylnitrous amide;4-nitrophenol?
The canonical SMILES for N,N-dipropylnitrous amide;4-nitrophenol is CCCN(CCC)N=O.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of N,N-dipropylnitrous amide;4-nitrophenol?
The InChIKey is VGWLCDKNPVPIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.C6H5NO3/c1-3-5-8(7-9)6-4-2;8-6-3-1-5(2-4-6)7(9)10/h3-6H2,1-2H3;1-4,8H.
What are the key properties of N,N-dipropylnitrous amide;4-nitrophenol?
N,N-dipropylnitrous amide;4-nitrophenol has a molecular weight of 269.30 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylnitrous amide;4-nitrophenol is sourced from PubChem (CID 138628252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).