About 4-nitrophenol;1-nonoxynonane
4-nitrophenol;1-nonoxynonane (PubChem CID 69294501) has the molecular formula C24H43NO4
and a molecular weight of 409.61 g/mol. Its IUPAC name is 4-nitrophenol;1-nonoxynonane.
Molecular Properties
| Compound Name | 4-nitrophenol;1-nonoxynonane |
| PubChem CID | 69294501 |
| Molecular Formula | C24H43NO4 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | 4-nitrophenol;1-nonoxynonane |
| SMILES | CCCCCCCCCOCCCCCCCCC.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C18H38O.C6H5NO3/c1-3-5-7-9-11-13-15-17-19-18-16-14-12-10-8-6-4-2;8-6-3-1-5(2-4-6)7(9)10/h3-18H2,1-2H3;1-4,8H |
| InChIKey | KVSPUBOUYPNVTR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrophenol;1-nonoxynonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrophenol;1-nonoxynonane?
The IUPAC name of 4-nitrophenol;1-nonoxynonane (CID 69294501) is 4-nitrophenol;1-nonoxynonane.
What is the SMILES notation for 4-nitrophenol;1-nonoxynonane?
The canonical SMILES for 4-nitrophenol;1-nonoxynonane is CCCCCCCCCOCCCCCCCCC.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 4-nitrophenol;1-nonoxynonane?
The InChIKey is KVSPUBOUYPNVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O.C6H5NO3/c1-3-5-7-9-11-13-15-17-19-18-16-14-12-10-8-6-4-2;8-6-3-1-5(2-4-6)7(9)10/h3-18H2,1-2H3;1-4,8H.
What are the key properties of 4-nitrophenol;1-nonoxynonane?
4-nitrophenol;1-nonoxynonane has a molecular weight of 409.61 g/mol, XLogP of 7.80, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrophenol;1-nonoxynonane is sourced from PubChem (CID 69294501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).