About hexane;4-nitrophenol;pyrene
hexane;4-nitrophenol;pyrene (PubChem CID 175425201) has the molecular formula C28H29NO3
and a molecular weight of 427.54 g/mol. Its IUPAC name is hexane;4-nitrophenol;pyrene.
Molecular Properties
| Compound Name | hexane;4-nitrophenol;pyrene |
| PubChem CID | 175425201 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | hexane;4-nitrophenol;pyrene |
| SMILES | CCCCCC.O=[N+]([O-])c1ccc(O)cc1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C6H5NO3.C6H14/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;8-6-3-1-5(2-4-6)7(9)10;1-3-5-6-4-2/h1-10H;1-4,8H;3-6H2,1-2H3 |
| InChIKey | QENFCRYZKPXQFD-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze hexane;4-nitrophenol;pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;4-nitrophenol;pyrene?
The IUPAC name of hexane;4-nitrophenol;pyrene (CID 175425201) is hexane;4-nitrophenol;pyrene.
What is the SMILES notation for hexane;4-nitrophenol;pyrene?
The canonical SMILES for hexane;4-nitrophenol;pyrene is CCCCCC.O=[N+]([O-])c1ccc(O)cc1.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of hexane;4-nitrophenol;pyrene?
The InChIKey is QENFCRYZKPXQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C6H5NO3.C6H14/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;8-6-3-1-5(2-4-6)7(9)10;1-3-5-6-4-2/h1-10H;1-4,8H;3-6H2,1-2H3.
What are the key properties of hexane;4-nitrophenol;pyrene?
hexane;4-nitrophenol;pyrene has a molecular weight of 427.54 g/mol, XLogP of 8.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;4-nitrophenol;pyrene is sourced from PubChem (CID 175425201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).