About 4-methylphenol;4-nitrophenol
4-methylphenol;4-nitrophenol (PubChem CID 68529378) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-methylphenol;4-nitrophenol.
Molecular Properties
| Compound Name | 4-methylphenol;4-nitrophenol |
| PubChem CID | 68529378 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-methylphenol;4-nitrophenol |
| SMILES | Cc1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O.C6H5NO3/c1-6-2-4-7(8)5-3-6;8-6-3-1-5(2-4-6)7(9)10/h2-5,8H,1H3;1-4,8H |
| InChIKey | YBOURULFYDXUJH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methylphenol;4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylphenol;4-nitrophenol?
The IUPAC name of 4-methylphenol;4-nitrophenol (CID 68529378) is 4-methylphenol;4-nitrophenol.
What is the SMILES notation for 4-methylphenol;4-nitrophenol?
The canonical SMILES for 4-methylphenol;4-nitrophenol is Cc1ccc(O)cc1.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 4-methylphenol;4-nitrophenol?
The InChIKey is YBOURULFYDXUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H5NO3/c1-6-2-4-7(8)5-3-6;8-6-3-1-5(2-4-6)7(9)10/h2-5,8H,1H3;1-4,8H.
What are the key properties of 4-methylphenol;4-nitrophenol?
4-methylphenol;4-nitrophenol has a molecular weight of 247.25 g/mol, XLogP of 3.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphenol;4-nitrophenol is sourced from PubChem (CID 68529378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).