About 1-methyl-4-nitrobenzene;molecular nitrogen
1-methyl-4-nitrobenzene;molecular nitrogen (PubChem CID 175124528) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 1-methyl-4-nitrobenzene;molecular nitrogen.
Molecular Properties
| Compound Name | 1-methyl-4-nitrobenzene;molecular nitrogen |
| PubChem CID | 175124528 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 1-methyl-4-nitrobenzene;molecular nitrogen |
| SMILES | Cc1ccc([N+](=O)[O-])cc1.N#N |
| InChI | InChI=1S/C7H7NO2.N2/c1-6-2-4-7(5-3-6)8(9)10;1-2/h2-5H,1H3; |
| InChIKey | IWACTELNQKWLCY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitrobenzene;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitrobenzene;molecular nitrogen?
The IUPAC name of 1-methyl-4-nitrobenzene;molecular nitrogen (CID 175124528) is 1-methyl-4-nitrobenzene;molecular nitrogen.
What is the SMILES notation for 1-methyl-4-nitrobenzene;molecular nitrogen?
The canonical SMILES for 1-methyl-4-nitrobenzene;molecular nitrogen is Cc1ccc([N+](=O)[O-])cc1.N#N.
What is the InChIKey of 1-methyl-4-nitrobenzene;molecular nitrogen?
The InChIKey is IWACTELNQKWLCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.N2/c1-6-2-4-7(5-3-6)8(9)10;1-2/h2-5H,1H3;.
What are the key properties of 1-methyl-4-nitrobenzene;molecular nitrogen?
1-methyl-4-nitrobenzene;molecular nitrogen has a molecular weight of 165.15 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitrobenzene;molecular nitrogen is sourced from PubChem (CID 175124528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).