About 1-chloropentane;4-nitrophenol
1-chloropentane;4-nitrophenol (PubChem CID 175271620) has the molecular formula C11H16ClNO3
and a molecular weight of 245.71 g/mol. Its IUPAC name is 1-chloropentane;4-nitrophenol.
Molecular Properties
| Compound Name | 1-chloropentane;4-nitrophenol |
| PubChem CID | 175271620 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-chloropentane;4-nitrophenol |
| SMILES | CCCCCCl.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C6H5NO3.C5H11Cl/c8-6-3-1-5(2-4-6)7(9)10;1-2-3-4-5-6/h1-4,8H;2-5H2,1H3 |
| InChIKey | XRAWAXRWGXTGEM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;4-nitrophenol?
The IUPAC name of 1-chloropentane;4-nitrophenol (CID 175271620) is 1-chloropentane;4-nitrophenol.
What is the SMILES notation for 1-chloropentane;4-nitrophenol?
The canonical SMILES for 1-chloropentane;4-nitrophenol is CCCCCCl.O=[N+]([O-])c1ccc(O)cc1.
What is the InChIKey of 1-chloropentane;4-nitrophenol?
The InChIKey is XRAWAXRWGXTGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.C5H11Cl/c8-6-3-1-5(2-4-6)7(9)10;1-2-3-4-5-6/h1-4,8H;2-5H2,1H3.
What are the key properties of 1-chloropentane;4-nitrophenol?
1-chloropentane;4-nitrophenol has a molecular weight of 245.71 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;4-nitrophenol is sourced from PubChem (CID 175271620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).