About N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide
N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide (PubChem CID 108513177) has the molecular formula C15H13N3O5
and a molecular weight of 315.29 g/mol. Its IUPAC name is N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide.
Molecular Properties
| Compound Name | N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide |
| PubChem CID | 108513177 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H13N3O5/c1-17(11-6-8-13(19)9-7-11)15(21)14(20)16-10-2-4-12(5-3-10)18(22)23/h2-9,19H,1H3,(H,16,20) |
| InChIKey | PUAGYLACQOEAAK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide?
The IUPAC name of N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide (CID 108513177) is N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide.
What is the SMILES notation for N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide?
The canonical SMILES for N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide is CN(C(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1)c1ccc(O)cc1.
What is the InChIKey of N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide?
The InChIKey is PUAGYLACQOEAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O5/c1-17(11-6-8-13(19)9-7-11)15(21)14(20)16-10-2-4-12(5-3-10)18(22)23/h2-9,19H,1H3,(H,16,20).
What are the key properties of N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide?
N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide has a molecular weight of 315.29 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-hydroxyphenyl)-N'-methyl-N-(4-nitrophenyl)oxamide is sourced from PubChem (CID 108513177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).