C17H18N2O3 — CID 108528473
N-(2,6-dimethylphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide (PubChem CID 108528473) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide.
| Compound Name | N-(2,6-dimethylphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108528473 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)N(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-11-5-4-6-12(2)15(11)18-16(21)17(22)19(3)13-7-9-14(20)10-8-13/h4-10,20H,1-3H3,(H,18,21) |
| InChIKey | JMBGMYZVPHJZHJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|