C17H17ClN2O2 — CID 108521008
N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108521008) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-phenyloxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108521008 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-phenyloxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)N(C)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-11-9-12(2)15(14(18)10-11)19-16(21)17(22)20(3)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,19,21) |
| InChIKey | XIXYAICJFVKTKL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|