C18H20ClN3O2 — CID 108985607
N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108985607) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108985607 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-methyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)N(C)CCc2ccncc2)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-12-10-13(2)16(15(19)11-12)21-17(23)18(24)22(3)9-6-14-4-7-20-8-5-14/h4-5,7-8,10-11H,6,9H2,1-3H3,(H,21,23) |
| InChIKey | HHKOHRCRMNVZJF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|