About 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea
3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea (PubChem CID 74246739) has the molecular formula C18H22ClN3O2
and a molecular weight of 347.85 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea.
Molecular Properties
| Compound Name | 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea |
| PubChem CID | 74246739 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(CCCO)Cc2ccncc2)c(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-13-10-14(2)17(16(19)11-13)21-18(24)22(8-3-9-23)12-15-4-6-20-7-5-15/h4-7,10-11,23H,3,8-9,12H2,1-2H3,(H,21,24) |
| InChIKey | DLZSADKCEYNDTC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea?
The IUPAC name of 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea (CID 74246739) is 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea.
What is the SMILES notation for 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea?
The canonical SMILES for 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea is Cc1cc(C)c(NC(=O)N(CCCO)Cc2ccncc2)c(Cl)c1.
What is the InChIKey of 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea?
The InChIKey is DLZSADKCEYNDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClN3O2/c1-13-10-14(2)17(16(19)11-13)21-18(24)22(8-3-9-23)12-15-4-6-20-7-5-15/h4-7,10-11,23H,3,8-9,12H2,1-2H3,(H,21,24).
What are the key properties of 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea?
3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea has a molecular weight of 347.85 g/mol, XLogP of 3.77, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,6-dimethylphenyl)-1-(3-hydroxypropyl)-1-(pyridin-4-ylmethyl)urea is sourced from PubChem (CID 74246739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).