C16H17Cl2N3O2 — CID 47815542
1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-pyridin-3-ylurea (PubChem CID 47815542) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-pyridin-3-ylurea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 47815542 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)N(CCCO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N3O2/c17-14-5-4-12(9-15(14)18)11-21(7-2-8-22)16(23)20-13-3-1-6-19-10-13/h1,3-6,9-10,22H,2,7-8,11H2,(H,20,23) |
| InChIKey | XVFFYIIRNMWNMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |