C17H17Cl2N3O4 — CID 47815545
1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-(4-nitrophenyl)urea (PubChem CID 47815545) has the molecular formula C17H17Cl2N3O4 and a molecular weight of 398.25 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 47815545 |
| Molecular Formula | C17H17Cl2N3O4 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-1-(3-hydroxypropyl)-3-(4-nitrophenyl)urea |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N(CCCO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O4/c18-15-7-2-12(10-16(15)19)11-21(8-1-9-23)17(24)20-13-3-5-14(6-4-13)22(25)26/h2-7,10,23H,1,8-9,11H2,(H,20,24) |
| InChIKey | HWXMMSNKSFBYAM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|