C29H25BrCl2N2O — CID 42657018
3-(4-bromophenyl)-1-[(3,4-dichlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea (PubChem CID 42657018) has the molecular formula C29H25BrCl2N2O and a molecular weight of 568.34 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[(3,4-dichlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea.
| Compound Name | 3-(4-bromophenyl)-1-[(3,4-dichlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 42657018 |
| Molecular Formula | C29H25BrCl2N2O |
| Molecular Weight | 568.34 g/mol |
| Exact Mass | 566.05 |
| IUPAC Name | 3-(4-bromophenyl)-1-[(3,4-dichlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
| SMILES | O=C(Nc1ccc(Br)cc1)N(CCC(c1ccccc1)c1ccccc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H25BrCl2N2O/c30-24-12-14-25(15-13-24)33-29(35)34(20-21-11-16-27(31)28(32)19-21)18-17-26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-16,19,26H,17-18,20H2,(H,33,35) |
| InChIKey | NMPGLSPWHZJJJA-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.34 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |