C29H26BrClN2O — CID 5108231
3-(3-bromophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea (PubChem CID 5108231) has the molecular formula C29H26BrClN2O and a molecular weight of 533.90 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea.
| Compound Name | 3-(3-bromophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 5108231 |
| Molecular Formula | C29H26BrClN2O |
| Molecular Weight | 533.90 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 3-(3-bromophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
| SMILES | O=C(Nc1cccc(Br)c1)N(CCC(c1ccccc1)c1ccccc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C29H26BrClN2O/c30-25-15-9-16-26(20-25)32-29(34)33(21-24-14-7-8-17-28(24)31)19-18-27(22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-17,20,27H,18-19,21H2,(H,32,34) |
| InChIKey | QQNVCGSCELORKX-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.90 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |