C29H26Cl2N2O — CID 4541691
3-(4-chlorophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea (PubChem CID 4541691) has the molecular formula C29H26Cl2N2O and a molecular weight of 489.45 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 4541691 |
| Molecular Formula | C29H26Cl2N2O |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(2-chlorophenyl)methyl]-1-(3,3-diphenylpropyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N(CCC(c1ccccc1)c1ccccc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C29H26Cl2N2O/c30-25-15-17-26(18-16-25)32-29(34)33(21-24-13-7-8-14-28(24)31)20-19-27(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-18,27H,19-21H2,(H,32,34) |
| InChIKey | UDZNXAYGPQSICA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |