C32H34N2O2 — CID 69028216
1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-(4-phenoxyphenyl)urea (PubChem CID 69028216) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 69028216 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-1-(2-methylpropyl)-3-(4-phenoxyphenyl)urea |
| SMILES | CC(C)CN(CCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O2/c1-25(2)24-34(23-22-31(26-12-6-3-7-13-26)27-14-8-4-9-15-27)32(35)33-28-18-20-30(21-19-28)36-29-16-10-5-11-17-29/h3-21,25,31H,22-24H2,1-2H3,(H,33,35) |
| InChIKey | QRGSBOQQFDMSTD-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |