C31H40N4O3 — CID 10142589
1-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-[3-[methyl-[3-(methylamino)propyl]amino]-2-oxopropyl]urea (PubChem CID 10142589) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-[3-[methyl-[3-(methylamino)propyl]amino]-2-oxopropyl]urea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-[3-[methyl-[3-(methylamino)propyl]amino]-2-oxopropyl]urea |
|---|---|
| PubChem CID | 10142589 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(4-methoxyphenyl)-1-[3-[methyl-[3-(methylamino)propyl]amino]-2-oxopropyl]urea |
| SMILES | CNCCCN(C)CC(=O)CN(CCC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H40N4O3/c1-32-20-10-21-34(2)23-28(36)24-35(31(37)33-27-15-17-29(38-3)18-16-27)22-19-30(25-11-6-4-7-12-25)26-13-8-5-9-14-26/h4-9,11-18,30,32H,10,19-24H2,1-3H3,(H,33,37) |
| InChIKey | NGHVCGOGGYVYEN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|