C30H36N2O2 — CID 42696184
3-cyclohexyl-1-(3,3-diphenylpropyl)-1-[(4-methoxyphenyl)methyl]urea (PubChem CID 42696184) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3,3-diphenylpropyl)-1-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 3-cyclohexyl-1-(3,3-diphenylpropyl)-1-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42696184 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 3-cyclohexyl-1-(3,3-diphenylpropyl)-1-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(CCC(c2ccccc2)c2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C30H36N2O2/c1-34-28-19-17-24(18-20-28)23-32(30(33)31-27-15-9-4-10-16-27)22-21-29(25-11-5-2-6-12-25)26-13-7-3-8-14-26/h2-3,5-8,11-14,17-20,27,29H,4,9-10,15-16,21-23H2,1H3,(H,31,33) |
| InChIKey | NKHKFFUHLVHTNQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |