C25H31ClN2O3 — CID 86810113
2-[benzyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-methoxyphenyl)acetamide (PubChem CID 86810113) has the molecular formula C25H31ClN2O3 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-[benzyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86810113 |
| Molecular Formula | C25H31ClN2O3 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[benzyl-(2-chloroacetyl)amino]-N-cycloheptyl-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCCC2)N(Cc2ccccc2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C25H31ClN2O3/c1-31-22-15-13-20(14-16-22)24(25(30)27-21-11-7-2-3-8-12-21)28(23(29)17-26)18-19-9-5-4-6-10-19/h4-6,9-10,13-16,21,24H,2-3,7-8,11-12,17-18H2,1H3,(H,27,30) |
| InChIKey | SWGYLHKTBMYBQC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|