C25H29ClN2O5 — CID 86809795
2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide (PubChem CID 86809795) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86809795 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl-(2-chloroacetyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCC2)N(Cc2ccc3c(c2)OCO3)C(=O)CCl)cc1 |
| InChI | InChI=1S/C25H29ClN2O5/c1-31-20-10-8-18(9-11-20)24(25(30)27-19-5-3-2-4-6-19)28(23(29)14-26)15-17-7-12-21-22(13-17)33-16-32-21/h7-13,19,24H,2-6,14-16H2,1H3,(H,27,30) |
| InChIKey | NQPCWKPQYQGQNF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|