C25H31ClN2O4 — CID 86809790
2-[(2-chloroacetyl)-[(4-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide (PubChem CID 86809790) has the molecular formula C25H31ClN2O4 and a molecular weight of 458.99 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-[(4-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-[(4-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86809790 |
| Molecular Formula | C25H31ClN2O4 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[(2-chloroacetyl)-[(4-methoxyphenyl)methyl]amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)CCl)C(C(=O)NC2CCCCC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H31ClN2O4/c1-31-21-12-8-18(9-13-21)17-28(23(29)16-26)24(19-10-14-22(32-2)15-11-19)25(30)27-20-6-4-3-5-7-20/h8-15,20,24H,3-7,16-17H2,1-2H3,(H,27,30) |
| InChIKey | RXFNJMPSVQBLES-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|