C22H31ClN2O4 — CID 86809784
2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide (PubChem CID 86809784) has the molecular formula C22H31ClN2O4 and a molecular weight of 422.95 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 86809784 |
| Molecular Formula | C22H31ClN2O4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[(2-chloroacetyl)-(oxolan-2-ylmethyl)amino]-N-cyclohexyl-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NC2CCCCC2)N(CC2CCCO2)C(=O)CCl)cc1 |
| InChI | InChI=1S/C22H31ClN2O4/c1-28-18-11-9-16(10-12-18)21(22(27)24-17-6-3-2-4-7-17)25(20(26)14-23)15-19-8-5-13-29-19/h9-12,17,19,21H,2-8,13-15H2,1H3,(H,24,27) |
| InChIKey | KGTZWNZKQIQARL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|