C25H37N3O5 — CID 25412994
N-cyclohexyl-N'-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-N'-propan-2-yloxamide (PubChem CID 25412994) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-N'-propan-2-yloxamide.
| Compound Name | N-cyclohexyl-N'-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 25412994 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | N-cyclohexyl-N'-[(1S)-1-(4-methoxyphenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl]-N'-propan-2-yloxamide |
| SMILES | COc1ccc([C@@H](C(=O)NC[C@H]2CCCO2)N(C(=O)C(=O)NC2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C25H37N3O5/c1-17(2)28(25(31)24(30)27-19-8-5-4-6-9-19)22(18-11-13-20(32-3)14-12-18)23(29)26-16-21-10-7-15-33-21/h11-14,17,19,21-22H,4-10,15-16H2,1-3H3,(H,26,29)(H,27,30)/t21-,22+/m1/s1 |
| InChIKey | LNTAYERLMQLRJC-YADHBBJMSA-N |
| XLogP | 2.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|