C25H33N3O4 — CID 25412970
N-cyclohexyl-N'-[(1S)-2-(furan-2-ylmethylamino)-1-(4-methylphenyl)-2-oxoethyl]-N'-propan-2-yloxamide (PubChem CID 25412970) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(1S)-2-(furan-2-ylmethylamino)-1-(4-methylphenyl)-2-oxoethyl]-N'-propan-2-yloxamide.
| Compound Name | N-cyclohexyl-N'-[(1S)-2-(furan-2-ylmethylamino)-1-(4-methylphenyl)-2-oxoethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 25412970 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-cyclohexyl-N'-[(1S)-2-(furan-2-ylmethylamino)-1-(4-methylphenyl)-2-oxoethyl]-N'-propan-2-yloxamide |
| SMILES | Cc1ccc([C@@H](C(=O)NCc2ccco2)N(C(=O)C(=O)NC2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-17(2)28(25(31)24(30)27-20-8-5-4-6-9-20)22(19-13-11-18(3)12-14-19)23(29)26-16-21-10-7-15-32-21/h7,10-15,17,20,22H,4-6,8-9,16H2,1-3H3,(H,26,29)(H,27,30)/t22-/m0/s1 |
| InChIKey | SBPHCWFCPRECHG-QFIPXVFZSA-N |
| XLogP | 3.63 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|