C20H31N3O5 — CID 7406773
N-cyclohexyl-N'-[(1S)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-propan-2-yloxamide (PubChem CID 7406773) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(1S)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-propan-2-yloxamide.
| Compound Name | N-cyclohexyl-N'-[(1S)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 7406773 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-cyclohexyl-N'-[(1S)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-propan-2-yloxamide |
| SMILES | COCCNC(=O)[C@H](c1ccco1)N(C(=O)C(=O)NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C20H31N3O5/c1-14(2)23(20(26)19(25)22-15-8-5-4-6-9-15)17(16-10-7-12-28-16)18(24)21-11-13-27-3/h7,10,12,14-15,17H,4-6,8-9,11,13H2,1-3H3,(H,21,24)(H,22,25)/t17-/m0/s1 |
| InChIKey | AVFCSJLMHKITNK-KRWDZBQOSA-N |
| XLogP | 1.77 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|