C24H31N3O5 — CID 3220053
N'-cyclopentyl-N-(2,3-dimethylphenyl)-N'-[1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide (PubChem CID 3220053) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N'-cyclopentyl-N-(2,3-dimethylphenyl)-N'-[1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide.
| Compound Name | N'-cyclopentyl-N-(2,3-dimethylphenyl)-N'-[1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 3220053 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N'-cyclopentyl-N-(2,3-dimethylphenyl)-N'-[1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
| SMILES | COCCNC(=O)C(c1ccco1)N(C(=O)C(=O)Nc1cccc(C)c1C)C1CCCC1 |
| InChI | InChI=1S/C24H31N3O5/c1-16-8-6-11-19(17(16)2)26-23(29)24(30)27(18-9-4-5-10-18)21(20-12-7-14-32-20)22(28)25-13-15-31-3/h6-8,11-12,14,18,21H,4-5,9-10,13,15H2,1-3H3,(H,25,28)(H,26,29) |
| InChIKey | SQFAPHMGJNHDLG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|