C22H26FN3O5 — CID 25412483
N-cyclopentyl-N'-(4-fluorophenyl)-N'-[(1R)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide (PubChem CID 25412483) has the molecular formula C22H26FN3O5 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-cyclopentyl-N'-(4-fluorophenyl)-N'-[(1R)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide.
| Compound Name | N-cyclopentyl-N'-(4-fluorophenyl)-N'-[(1R)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 25412483 |
| Molecular Formula | C22H26FN3O5 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-cyclopentyl-N'-(4-fluorophenyl)-N'-[(1R)-1-(furan-2-yl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
| SMILES | COCCNC(=O)[C@@H](c1ccco1)N(C(=O)C(=O)NC1CCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN3O5/c1-30-14-12-24-20(27)19(18-7-4-13-31-18)26(17-10-8-15(23)9-11-17)22(29)21(28)25-16-5-2-3-6-16/h4,7-11,13,16,19H,2-3,5-6,12,14H2,1H3,(H,24,27)(H,25,28)/t19-/m1/s1 |
| InChIKey | FENLMNBKNAYODQ-LJQANCHMSA-N |
| XLogP | 2.31 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|