C25H31N3O5 — CID 25412581
N-cyclopentyl-N'-(furan-2-ylmethyl)-N'-[(1R)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]-1-phenylethyl]oxamide (PubChem CID 25412581) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-cyclopentyl-N'-(furan-2-ylmethyl)-N'-[(1R)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]-1-phenylethyl]oxamide.
| Compound Name | N-cyclopentyl-N'-(furan-2-ylmethyl)-N'-[(1R)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 25412581 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-cyclopentyl-N'-(furan-2-ylmethyl)-N'-[(1R)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]-1-phenylethyl]oxamide |
| SMILES | O=C(NC1CCCC1)C(=O)N(Cc1ccco1)[C@@H](C(=O)NC[C@H]1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O5/c29-23(26-16-20-12-6-14-32-20)22(18-8-2-1-3-9-18)28(17-21-13-7-15-33-21)25(31)24(30)27-19-10-4-5-11-19/h1-3,7-9,13,15,19-20,22H,4-6,10-12,14,16-17H2,(H,26,29)(H,27,30)/t20-,22-/m1/s1 |
| InChIKey | PZZPLVXZBLGQCZ-IFMALSPDSA-N |
| XLogP | 2.70 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|