C26H36FN3O5 — CID 3220020
N-cyclohexyl-N'-[1-(2-fluorophenyl)-2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-N'-(oxolan-2-ylmethyl)oxamide (PubChem CID 3220020) has the molecular formula C26H36FN3O5 and a molecular weight of 489.59 g/mol. Its IUPAC name is N-cyclohexyl-N'-[1-(2-fluorophenyl)-2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-N'-(oxolan-2-ylmethyl)oxamide.
| Compound Name | N-cyclohexyl-N'-[1-(2-fluorophenyl)-2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-N'-(oxolan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 3220020 |
| Molecular Formula | C26H36FN3O5 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N-cyclohexyl-N'-[1-(2-fluorophenyl)-2-oxo-2-(oxolan-2-ylmethylamino)ethyl]-N'-(oxolan-2-ylmethyl)oxamide |
| SMILES | O=C(NC1CCCCC1)C(=O)N(CC1CCCO1)C(C(=O)NCC1CCCO1)c1ccccc1F |
| InChI | InChI=1S/C26H36FN3O5/c27-22-13-5-4-12-21(22)23(24(31)28-16-19-10-6-14-34-19)30(17-20-11-7-15-35-20)26(33)25(32)29-18-8-2-1-3-9-18/h4-5,12-13,18-20,23H,1-3,6-11,14-17H2,(H,28,31)(H,29,32) |
| InChIKey | LSFUSDITIMIMKV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|