C23H32FN3O4 — CID 25412806
N-cyclopentyl-N'-[(1S)-2-(cyclopentylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(2-methoxyethyl)oxamide (PubChem CID 25412806) has the molecular formula C23H32FN3O4 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-cyclopentyl-N'-[(1S)-2-(cyclopentylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-cyclopentyl-N'-[(1S)-2-(cyclopentylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 25412806 |
| Molecular Formula | C23H32FN3O4 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-cyclopentyl-N'-[(1S)-2-(cyclopentylamino)-1-(2-fluorophenyl)-2-oxoethyl]-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)NC1CCCC1)[C@H](C(=O)NC1CCCC1)c1ccccc1F |
| InChI | InChI=1S/C23H32FN3O4/c1-31-15-14-27(23(30)22(29)26-17-10-4-5-11-17)20(18-12-6-7-13-19(18)24)21(28)25-16-8-2-3-9-16/h6-7,12-13,16-17,20H,2-5,8-11,14-15H2,1H3,(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | GIBKCENTAMKBIQ-FQEVSTJZSA-N |
| XLogP | 2.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|