C14H26N2O4 — CID 108504409
N-cyclohexyl-N',N'-bis(2-methoxyethyl)oxamide (PubChem CID 108504409) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-cyclohexyl-N',N'-bis(2-methoxyethyl)oxamide.
| Compound Name | N-cyclohexyl-N',N'-bis(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108504409 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-cyclohexyl-N',N'-bis(2-methoxyethyl)oxamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H26N2O4/c1-19-10-8-16(9-11-20-2)14(18)13(17)15-12-6-4-3-5-7-12/h12H,3-11H2,1-2H3,(H,15,17) |
| InChIKey | WCTAYIKHJXBIBA-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|