About N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide
N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide (PubChem CID 108504394) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide |
| PubChem CID | 108504394 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide |
| SMILES | CN(CCO)C(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H20N2O3/c1-13(7-8-14)11(16)10(15)12-9-5-3-2-4-6-9/h9,14H,2-8H2,1H3,(H,12,15) |
| InChIKey | XPMNCFPAKBUTRC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide?
The IUPAC name of N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide (CID 108504394) is N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide.
What is the SMILES notation for N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide?
The canonical SMILES for N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide is CN(CCO)C(=O)C(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide?
The InChIKey is XPMNCFPAKBUTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-13(7-8-14)11(16)10(15)12-9-5-3-2-4-6-9/h9,14H,2-8H2,1H3,(H,12,15).
What are the key properties of N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide?
N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide has a molecular weight of 228.29 g/mol, XLogP of -0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N'-(2-hydroxyethyl)-N'-methyloxamide is sourced from PubChem (CID 108504394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).