C16H29N3O2 — CID 108507306
N-cycloheptyl-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide (PubChem CID 108507306) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-cycloheptyl-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide.
| Compound Name | N-cycloheptyl-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108507306 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-cycloheptyl-N'-methyl-N'-(1-methylpiperidin-4-yl)oxamide |
| SMILES | CN1CCC(N(C)C(=O)C(=O)NC2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H29N3O2/c1-18-11-9-14(10-12-18)19(2)16(21)15(20)17-13-7-5-3-4-6-8-13/h13-14H,3-12H2,1-2H3,(H,17,20) |
| InChIKey | BUIPJZJEBWTJOY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|